C12H14O — CID 102250646
penta-1,4-dien-3-yloxymethylbenzene (PubChem CID 102250646) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is penta-1,4-dien-3-yloxymethylbenzene.
| Compound Name | penta-1,4-dien-3-yloxymethylbenzene |
|---|---|
| PubChem CID | 102250646 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | penta-1,4-dien-3-yloxymethylbenzene |
| SMILES | C=CC(C=C)OCc1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-3-12(4-2)13-10-11-8-6-5-7-9-11/h3-9,12H,1-2,10H2 |
| InChIKey | HLKOHQMNXICOQT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|