C20H28O — CID 12023386
[(4E)-5,8,9-trimethyldeca-1,4,8-trien-3-yl]oxymethylbenzene (PubChem CID 12023386) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is [(4E)-5,8,9-trimethyldeca-1,4,8-trien-3-yl]oxymethylbenzene.
| Compound Name | [(4E)-5,8,9-trimethyldeca-1,4,8-trien-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 12023386 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | [(4E)-5,8,9-trimethyldeca-1,4,8-trien-3-yl]oxymethylbenzene |
| SMILES | C=CC(/C=C(\C)CCC(C)=C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C20H28O/c1-6-20(21-15-19-10-8-7-9-11-19)14-17(4)12-13-18(5)16(2)3/h6-11,14,20H,1,12-13,15H2,2-5H3/b17-14+ |
| InChIKey | ZASGOLKXVIKVIH-SAPNQHFASA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|