C20H22O2 — CID 10756228
[(3R,4R)-4-phenylmethoxyhexa-1,5-dien-3-yl]oxymethylbenzene (PubChem CID 10756228) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(3R,4R)-4-phenylmethoxyhexa-1,5-dien-3-yl]oxymethylbenzene.
| Compound Name | [(3R,4R)-4-phenylmethoxyhexa-1,5-dien-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 10756228 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [(3R,4R)-4-phenylmethoxyhexa-1,5-dien-3-yl]oxymethylbenzene |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-3-19(21-15-17-11-7-5-8-12-17)20(4-2)22-16-18-13-9-6-10-14-18/h3-14,19-20H,1-2,15-16H2/t19-,20-/m1/s1 |
| InChIKey | SIDNFRGHUJGCFX-WOJBJXKFSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|