C42H44O5 — CID 101489173
[(1R,2S)-2-phenylmethoxy-1-[(1S,2R)-1,2,3-tris(phenylmethoxy)propyl]but-3-enoxy]methylbenzene (PubChem CID 101489173) has the molecular formula C42H44O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is [(1R,2S)-2-phenylmethoxy-1-[(1S,2R)-1,2,3-tris(phenylmethoxy)propyl]but-3-enoxy]methylbenzene.
| Compound Name | [(1R,2S)-2-phenylmethoxy-1-[(1S,2R)-1,2,3-tris(phenylmethoxy)propyl]but-3-enoxy]methylbenzene |
|---|---|
| PubChem CID | 101489173 |
| Molecular Formula | C42H44O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | [(1R,2S)-2-phenylmethoxy-1-[(1S,2R)-1,2,3-tris(phenylmethoxy)propyl]but-3-enoxy]methylbenzene |
| SMILES | C=C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C42H44O5/c1-2-39(44-29-35-20-10-4-11-21-35)41(46-31-37-24-14-6-15-25-37)42(47-32-38-26-16-7-17-27-38)40(45-30-36-22-12-5-13-23-36)33-43-28-34-18-8-3-9-19-34/h2-27,39-42H,1,28-33H2/t39-,40+,41+,42-/m0/s1 |
| InChIKey | LCSNZOSKDGZCDI-YIEWKAQUSA-N |
| XLogP | 8.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|