C28H32O6S — CID 102509147
[(2R,3R,4S)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl] methanesulfonate (PubChem CID 102509147) has the molecular formula C28H32O6S and a molecular weight of 496.63 g/mol. Its IUPAC name is [(2R,3R,4S)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl] methanesulfonate.
| Compound Name | [(2R,3R,4S)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 102509147 |
| Molecular Formula | C28H32O6S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [(2R,3R,4S)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl] methanesulfonate |
| SMILES | C=C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C28H32O6S/c1-3-26(32-20-24-15-9-5-10-16-24)28(33-21-25-17-11-6-12-18-25)27(34-35(2,29)30)22-31-19-23-13-7-4-8-14-23/h3-18,26-28H,1,19-22H2,2H3/t26-,27+,28+/m0/s1 |
| InChIKey | XSQOLJJRESVNLR-UPRLRBBYSA-N |
| XLogP | 4.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|