C33H43NO8S — CID 25207922
[(2R,3S,4R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] methanesulfonate (PubChem CID 25207922) has the molecular formula C33H43NO8S and a molecular weight of 613.77 g/mol. Its IUPAC name is [(2R,3S,4R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 25207922 |
| Molecular Formula | C33H43NO8S |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | [(2R,3S,4R)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3,4-tris(phenylmethoxy)hexan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C33H43NO8S/c1-33(2,3)41-32(35)34-21-20-29(39-23-27-16-10-6-11-17-27)31(40-24-28-18-12-7-13-19-28)30(42-43(4,36)37)25-38-22-26-14-8-5-9-15-26/h5-19,29-31H,20-25H2,1-4H3,(H,34,35)/t29-,30-,31+/m1/s1 |
| InChIKey | WPOYQVYXVDHYIQ-OLUZHXLYSA-N |
| XLogP | 5.63 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|