C17H27NO5 — CID 86645501
tert-butyl N-[2-(1-hydroxy-3-phenylmethoxypropan-2-yl)oxyethyl]carbamate (PubChem CID 86645501) has the molecular formula C17H27NO5 and a molecular weight of 325.40 g/mol. Its IUPAC name is tert-butyl N-[2-(1-hydroxy-3-phenylmethoxypropan-2-yl)oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-hydroxy-3-phenylmethoxypropan-2-yl)oxyethyl]carbamate |
|---|---|
| PubChem CID | 86645501 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl N-[2-(1-hydroxy-3-phenylmethoxypropan-2-yl)oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOC(CO)COCc1ccccc1 |
| InChI | InChI=1S/C17H27NO5/c1-17(2,3)23-16(20)18-9-10-22-15(11-19)13-21-12-14-7-5-4-6-8-14/h4-8,15,19H,9-13H2,1-3H3,(H,18,20) |
| InChIKey | LRCAZNQJKBSZAV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|