C15H23NO4 — CID 175101477
[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate (PubChem CID 175101477) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175101477 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](CO)COCc1ccccc1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)16-14(18)20-13(9-17)11-19-10-12-7-5-4-6-8-12/h4-8,13,17H,9-11H2,1-3H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | OKJWGDQPMNQGFC-CYBMUJFWSA-N |
| XLogP | 2.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |