C17H27NO4 — CID 90840160
2-(2-phenylmethoxyethoxy)propyl N-tert-butylcarbamate (PubChem CID 90840160) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(2-phenylmethoxyethoxy)propyl N-tert-butylcarbamate.
| Compound Name | 2-(2-phenylmethoxyethoxy)propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90840160 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-(2-phenylmethoxyethoxy)propyl N-tert-butylcarbamate |
| SMILES | CC(COC(=O)NC(C)(C)C)OCCOCc1ccccc1 |
| InChI | InChI=1S/C17H27NO4/c1-14(12-22-16(19)18-17(2,3)4)21-11-10-20-13-15-8-6-5-7-9-15/h5-9,14H,10-13H2,1-4H3,(H,18,19) |
| InChIKey | IIEWXIIROADTOT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|