C22H29FN2O2 — CID 135206134
[2-(dibenzylamino)-3-fluoropropyl] N-tert-butylcarbamate (PubChem CID 135206134) has the molecular formula C22H29FN2O2 and a molecular weight of 372.48 g/mol. Its IUPAC name is [2-(dibenzylamino)-3-fluoropropyl] N-tert-butylcarbamate.
| Compound Name | [2-(dibenzylamino)-3-fluoropropyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 135206134 |
| Molecular Formula | C22H29FN2O2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | [2-(dibenzylamino)-3-fluoropropyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC(CF)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H29FN2O2/c1-22(2,3)24-21(26)27-17-20(14-23)25(15-18-10-6-4-7-11-18)16-19-12-8-5-9-13-19/h4-13,20H,14-17H2,1-3H3,(H,24,26) |
| InChIKey | GBNANBCGMTYDFR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |