C23H32N2O4 — CID 142106690
3-[benzyl-[(1R)-1,2-dihydroxy-1-phenylethyl]amino]propyl N-tert-butylcarbamate (PubChem CID 142106690) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-[benzyl-[(1R)-1,2-dihydroxy-1-phenylethyl]amino]propyl N-tert-butylcarbamate.
| Compound Name | 3-[benzyl-[(1R)-1,2-dihydroxy-1-phenylethyl]amino]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 142106690 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-[benzyl-[(1R)-1,2-dihydroxy-1-phenylethyl]amino]propyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCN(Cc1ccccc1)[C@](O)(CO)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O4/c1-22(2,3)24-21(27)29-16-10-15-25(17-19-11-6-4-7-12-19)23(28,18-26)20-13-8-5-9-14-20/h4-9,11-14,26,28H,10,15-18H2,1-3H3,(H,24,27)/t23-/m0/s1 |
| InChIKey | LGGHGWNGKQFCNO-QHCPKHFHSA-N |
| XLogP | 3.24 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|