C28H39N3O6 — CID 122598408
3-[2-[3-[2-(propoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]propyl N-benzylcarbamate (PubChem CID 122598408) has the molecular formula C28H39N3O6 and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-[2-[3-[2-(propoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]propyl N-benzylcarbamate.
| Compound Name | 3-[2-[3-[2-(propoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]propyl N-benzylcarbamate |
|---|---|
| PubChem CID | 122598408 |
| Molecular Formula | C28H39N3O6 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 3-[2-[3-[2-(propoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]propyl N-benzylcarbamate |
| SMILES | CCCOC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OCCCOC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H39N3O6/c1-6-16-35-25(33)30-27(2,3)22-14-10-15-23(19-22)28(4,5)31-26(34)37-18-11-17-36-24(32)29-20-21-12-8-7-9-13-21/h7-10,12-15,19H,6,11,16-18,20H2,1-5H3,(H,29,32)(H,30,33)(H,31,34) |
| InChIKey | ARDDRTIBPLQGGJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|