C32H38N4O8 — CID 118581814
3-(phenylmethoxycarbonylamino)propyl N-[[3-[[3-(phenylmethoxycarbonylamino)propoxycarbonylamino]methyl]phenyl]methyl]carbamate (PubChem CID 118581814) has the molecular formula C32H38N4O8 and a molecular weight of 606.68 g/mol. Its IUPAC name is 3-(phenylmethoxycarbonylamino)propyl N-[[3-[[3-(phenylmethoxycarbonylamino)propoxycarbonylamino]methyl]phenyl]methyl]carbamate.
| Compound Name | 3-(phenylmethoxycarbonylamino)propyl N-[[3-[[3-(phenylmethoxycarbonylamino)propoxycarbonylamino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118581814 |
| Molecular Formula | C32H38N4O8 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 3-(phenylmethoxycarbonylamino)propyl N-[[3-[[3-(phenylmethoxycarbonylamino)propoxycarbonylamino]methyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1cccc(CNC(=O)OCCCNC(=O)OCc2ccccc2)c1)OCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H38N4O8/c37-29(43-23-25-10-3-1-4-11-25)33-16-8-18-41-31(39)35-21-27-14-7-15-28(20-27)22-36-32(40)42-19-9-17-34-30(38)44-24-26-12-5-2-6-13-26/h1-7,10-15,20H,8-9,16-19,21-24H2,(H,33,37)(H,34,38)(H,35,39)(H,36,40) |
| InChIKey | BYCQKJXMJFFBAR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|