C23H29N3O5 — CID 140515450
methyl 2-[3-[[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]methyl]phenyl]acetate (PubChem CID 140515450) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is methyl 2-[3-[[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 140515450 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | methyl 2-[3-[[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(CNC(=O)[C@@H](N)CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O5/c1-30-21(27)14-18-9-5-10-19(13-18)15-26-22(28)20(24)11-6-12-25-23(29)31-16-17-7-3-2-4-8-17/h2-5,7-10,13,20H,6,11-12,14-16,24H2,1H3,(H,25,29)(H,26,28)/t20-/m0/s1 |
| InChIKey | RWOWYMYWQFPNFQ-FQEVSTJZSA-N |
| XLogP | 2.05 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|