C22H27N3O6 — CID 91032523
methyl 2-[2-[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]phenoxy]acetate (PubChem CID 91032523) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is methyl 2-[2-[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[2-[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 91032523 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | methyl 2-[2-[[(2S)-2-amino-5-(phenylmethoxycarbonylamino)pentanoyl]amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1NC(=O)[C@@H](N)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O6/c1-29-20(26)15-30-19-12-6-5-11-18(19)25-21(27)17(23)10-7-13-24-22(28)31-14-16-8-3-2-4-9-16/h2-6,8-9,11-12,17H,7,10,13-15,23H2,1H3,(H,24,28)(H,25,27)/t17-/m0/s1 |
| InChIKey | LPVGGJCWQFPRQP-KRWDZBQOSA-N |
| XLogP | 2.21 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|