C34H40N2O8 — CID 159969461
3-[[3-[[3-(3-phenylpropanoyloxy)propoxycarbonylamino]methyl]phenyl]methylcarbamoyloxy]propyl 3-phenylpropanoate (PubChem CID 159969461) has the molecular formula C34H40N2O8 and a molecular weight of 604.70 g/mol. Its IUPAC name is 3-[[3-[[3-(3-phenylpropanoyloxy)propoxycarbonylamino]methyl]phenyl]methylcarbamoyloxy]propyl 3-phenylpropanoate.
| Compound Name | 3-[[3-[[3-(3-phenylpropanoyloxy)propoxycarbonylamino]methyl]phenyl]methylcarbamoyloxy]propyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 159969461 |
| Molecular Formula | C34H40N2O8 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | 3-[[3-[[3-(3-phenylpropanoyloxy)propoxycarbonylamino]methyl]phenyl]methylcarbamoyloxy]propyl 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OCCCOC(=O)NCc1cccc(CNC(=O)OCCCOC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C34H40N2O8/c37-31(18-16-27-10-3-1-4-11-27)41-20-8-22-43-33(39)35-25-29-14-7-15-30(24-29)26-36-34(40)44-23-9-21-42-32(38)19-17-28-12-5-2-6-13-28/h1-7,10-15,24H,8-9,16-23,25-26H2,(H,35,39)(H,36,40) |
| InChIKey | PRNLFKWKYDYHMU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|