About 3-(propylamino)propyl 3-phenylpropanoate
3-(propylamino)propyl 3-phenylpropanoate (PubChem CID 82532717) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 3-(propylamino)propyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | 3-(propylamino)propyl 3-phenylpropanoate |
| PubChem CID | 82532717 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 3-(propylamino)propyl 3-phenylpropanoate |
| SMILES | CCCNCCCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C15H23NO2/c1-2-11-16-12-6-13-18-15(17)10-9-14-7-4-3-5-8-14/h3-5,7-8,16H,2,6,9-13H2,1H3 |
| InChIKey | ROXKAQWEXHSBHV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(propylamino)propyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propylamino)propyl 3-phenylpropanoate?
The IUPAC name of 3-(propylamino)propyl 3-phenylpropanoate (CID 82532717) is 3-(propylamino)propyl 3-phenylpropanoate.
What is the SMILES notation for 3-(propylamino)propyl 3-phenylpropanoate?
The canonical SMILES for 3-(propylamino)propyl 3-phenylpropanoate is CCCNCCCOC(=O)CCc1ccccc1.
What is the InChIKey of 3-(propylamino)propyl 3-phenylpropanoate?
The InChIKey is ROXKAQWEXHSBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-2-11-16-12-6-13-18-15(17)10-9-14-7-4-3-5-8-14/h3-5,7-8,16H,2,6,9-13H2,1H3.
What are the key properties of 3-(propylamino)propyl 3-phenylpropanoate?
3-(propylamino)propyl 3-phenylpropanoate has a molecular weight of 249.35 g/mol, XLogP of 2.55, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propylamino)propyl 3-phenylpropanoate is sourced from PubChem (CID 82532717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).