About 4-phenylbutyl butanoate
4-phenylbutyl butanoate (PubChem CID 59678642) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 4-phenylbutyl butanoate.
Molecular Properties
| Compound Name | 4-phenylbutyl butanoate |
| PubChem CID | 59678642 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 4-phenylbutyl butanoate |
| SMILES | CCCC(=O)OCCCCc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-2-8-14(15)16-12-7-6-11-13-9-4-3-5-10-13/h3-5,9-10H,2,6-8,11-12H2,1H3 |
| InChIKey | MFCPFXHSBOWLDK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutyl butanoate?
The IUPAC name of 4-phenylbutyl butanoate (CID 59678642) is 4-phenylbutyl butanoate.
What is the SMILES notation for 4-phenylbutyl butanoate?
The canonical SMILES for 4-phenylbutyl butanoate is CCCC(=O)OCCCCc1ccccc1.
What is the InChIKey of 4-phenylbutyl butanoate?
The InChIKey is MFCPFXHSBOWLDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-2-8-14(15)16-12-7-6-11-13-9-4-3-5-10-13/h3-5,9-10H,2,6-8,11-12H2,1H3.
What are the key properties of 4-phenylbutyl butanoate?
4-phenylbutyl butanoate has a molecular weight of 220.31 g/mol, XLogP of 3.35, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutyl butanoate is sourced from PubChem (CID 59678642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).