C32H44N2O8 — CID 161255572
3-(3-phenylpropanoyloxy)propyl 8-[3-(benzylcarbamoyloxy)propoxycarbonylamino]octanoate (PubChem CID 161255572) has the molecular formula C32H44N2O8 and a molecular weight of 584.71 g/mol. Its IUPAC name is 3-(3-phenylpropanoyloxy)propyl 8-[3-(benzylcarbamoyloxy)propoxycarbonylamino]octanoate.
| Compound Name | 3-(3-phenylpropanoyloxy)propyl 8-[3-(benzylcarbamoyloxy)propoxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 161255572 |
| Molecular Formula | C32H44N2O8 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 3-(3-phenylpropanoyloxy)propyl 8-[3-(benzylcarbamoyloxy)propoxycarbonylamino]octanoate |
| SMILES | O=C(CCCCCCCNC(=O)OCCCOC(=O)NCc1ccccc1)OCCCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H44N2O8/c35-29(39-22-12-23-40-30(36)20-19-27-14-6-4-7-15-27)18-10-2-1-3-11-21-33-31(37)41-24-13-25-42-32(38)34-26-28-16-8-5-9-17-28/h4-9,14-17H,1-3,10-13,18-26H2,(H,33,37)(H,34,38) |
| InChIKey | YICWRPHKJKPACA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|