C24H28N2O8 — CID 158664121
2-(phenylcarbamoyloxy)ethyl 4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate (PubChem CID 158664121) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-(phenylcarbamoyloxy)ethyl 4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate.
| Compound Name | 2-(phenylcarbamoyloxy)ethyl 4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 158664121 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-(phenylcarbamoyloxy)ethyl 4-[2-(2-phenylacetyl)oxyethoxycarbonylamino]butanoate |
| SMILES | O=C(CCCNC(=O)OCCOC(=O)Cc1ccccc1)OCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H28N2O8/c27-21(31-14-17-34-24(30)26-20-10-5-2-6-11-20)12-7-13-25-23(29)33-16-15-32-22(28)18-19-8-3-1-4-9-19/h1-6,8-11H,7,12-18H2,(H,25,29)(H,26,30) |
| InChIKey | IIBOWPMCDAIKHI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|