C15H22N2O5S — CID 88978473
2-[2-(3-sulfanylpropylcarbamoyloxy)ethoxy]ethyl N-phenylcarbamate (PubChem CID 88978473) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[2-(3-sulfanylpropylcarbamoyloxy)ethoxy]ethyl N-phenylcarbamate.
| Compound Name | 2-[2-(3-sulfanylpropylcarbamoyloxy)ethoxy]ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 88978473 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[2-(3-sulfanylpropylcarbamoyloxy)ethoxy]ethyl N-phenylcarbamate |
| SMILES | O=C(NCCCS)OCCOCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H22N2O5S/c18-14(16-7-4-12-23)21-10-8-20-9-11-22-15(19)17-13-5-2-1-3-6-13/h1-3,5-6,23H,4,7-12H2,(H,16,18)(H,17,19) |
| InChIKey | OLVVIZBSGCCIGL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|