C22H20N2O4 — CID 15528686
8-(phenylcarbamoyloxy)octa-3,5-diynyl N-phenylcarbamate (PubChem CID 15528686) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 8-(phenylcarbamoyloxy)octa-3,5-diynyl N-phenylcarbamate.
| Compound Name | 8-(phenylcarbamoyloxy)octa-3,5-diynyl N-phenylcarbamate |
|---|---|
| PubChem CID | 15528686 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 8-(phenylcarbamoyloxy)octa-3,5-diynyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCC#CC#CCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c25-21(23-19-13-7-5-8-14-19)27-17-11-3-1-2-4-12-18-28-22(26)24-20-15-9-6-10-16-20/h5-10,13-16H,11-12,17-18H2,(H,23,25)(H,24,26) |
| InChIKey | CTQSEIFHUYZPSY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|