C20H18N2O2 — CID 101378452
8-pyridin-4-ylocta-5,7-diynyl N-phenylcarbamate (PubChem CID 101378452) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 8-pyridin-4-ylocta-5,7-diynyl N-phenylcarbamate.
| Compound Name | 8-pyridin-4-ylocta-5,7-diynyl N-phenylcarbamate |
|---|---|
| PubChem CID | 101378452 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 8-pyridin-4-ylocta-5,7-diynyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCCCC#CC#Cc1ccncc1 |
| InChI | InChI=1S/C20H18N2O2/c23-20(22-19-11-7-5-8-12-19)24-17-9-4-2-1-3-6-10-18-13-15-21-16-14-18/h5,7-8,11-16H,2,4,9,17H2,(H,22,23) |
| InChIKey | XJFSUFFRRVOPCN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|