C19H39NO5Si4 — CID 70115266
3-tris(trimethylsilyloxy)silylpropyl N-phenylcarbamate (PubChem CID 70115266) has the molecular formula C19H39NO5Si4 and a molecular weight of 473.87 g/mol. Its IUPAC name is 3-tris(trimethylsilyloxy)silylpropyl N-phenylcarbamate.
| Compound Name | 3-tris(trimethylsilyloxy)silylpropyl N-phenylcarbamate |
|---|---|
| PubChem CID | 70115266 |
| Molecular Formula | C19H39NO5Si4 |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 3-tris(trimethylsilyloxy)silylpropyl N-phenylcarbamate |
| SMILES | C[Si](C)(C)O[Si](CCCOC(=O)Nc1ccccc1)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H39NO5Si4/c1-26(2,3)23-29(24-27(4,5)6,25-28(7,8)9)17-13-16-22-19(21)20-18-14-11-10-12-15-18/h10-12,14-15H,13,16-17H2,1-9H3,(H,20,21) |
| InChIKey | NHHHTYBESTYTII-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|