C16H27NO3Si — CID 177244740
3-[tert-butyl(dimethyl)silyl]oxypropyl N-phenylcarbamate (PubChem CID 177244740) has the molecular formula C16H27NO3Si and a molecular weight of 309.48 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropyl N-phenylcarbamate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl N-phenylcarbamate |
|---|---|
| PubChem CID | 177244740 |
| Molecular Formula | C16H27NO3Si |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl N-phenylcarbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H27NO3Si/c1-16(2,3)21(4,5)20-13-9-12-19-15(18)17-14-10-7-6-8-11-14/h6-8,10-11H,9,12-13H2,1-5H3,(H,17,18) |
| InChIKey | HDCSFXCNWUKYMY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|