C24H43NO2Si — CID 172564229
(4S,5S)-4-anilino-9-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylnonan-3-one (PubChem CID 172564229) has the molecular formula C24H43NO2Si and a molecular weight of 405.70 g/mol. Its IUPAC name is (4S,5S)-4-anilino-9-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylnonan-3-one.
| Compound Name | (4S,5S)-4-anilino-9-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylnonan-3-one |
|---|---|
| PubChem CID | 172564229 |
| Molecular Formula | C24H43NO2Si |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | (4S,5S)-4-anilino-9-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethylnonan-3-one |
| SMILES | C[C@@H](CCCCO[Si](C)(C)C(C)(C)C)[C@H](Nc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H43NO2Si/c1-19(15-13-14-18-27-28(8,9)24(5,6)7)21(22(26)23(2,3)4)25-20-16-11-10-12-17-20/h10-12,16-17,19,21,25H,13-15,18H2,1-9H3/t19-,21-/m0/s1 |
| InChIKey | XHMIANQKFKUSGD-FPOVZHCZSA-N |
| XLogP | 6.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|