C15H33NO3Si — CID 142782912
8-[tert-butyl(dimethyl)silyl]oxy-2-(methylamino)octanoic acid (PubChem CID 142782912) has the molecular formula C15H33NO3Si and a molecular weight of 303.52 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-2-(methylamino)octanoic acid.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-2-(methylamino)octanoic acid |
|---|---|
| PubChem CID | 142782912 |
| Molecular Formula | C15H33NO3Si |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-2-(methylamino)octanoic acid |
| SMILES | CNC(CCCCCCO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H33NO3Si/c1-15(2,3)20(5,6)19-12-10-8-7-9-11-13(16-4)14(17)18/h13,16H,7-12H2,1-6H3,(H,17,18) |
| InChIKey | UMDFRYWORYRBQI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|