About 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate
5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate (PubChem CID 171051892) has the molecular formula C27H56O3Si
and a molecular weight of 456.83 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate.
Molecular Properties
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate |
| PubChem CID | 171051892 |
| Molecular Formula | C27H56O3Si |
| Molecular Weight | 456.83 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O3Si/c1-8-10-12-14-15-18-22-25(21-17-13-11-9-2)26(28)29-23-19-16-20-24-30-31(6,7)27(3,4)5/h25H,8-24H2,1-7H3 |
| InChIKey | SWGMHTVPTURMJJ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.83 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate?
The IUPAC name of 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate (CID 171051892) is 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate.
What is the SMILES notation for 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate?
The canonical SMILES for 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate is CCCCCCCCC(CCCCCC)C(=O)OCCCCCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate?
The InChIKey is SWGMHTVPTURMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H56O3Si/c1-8-10-12-14-15-18-22-25(21-17-13-11-9-2)26(28)29-23-19-16-20-24-30-31(6,7)27(3,4)5/h25H,8-24H2,1-7H3.
What are the key properties of 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate?
5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate has a molecular weight of 456.83 g/mol, XLogP of 9.06, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[tert-butyl(dimethyl)silyl]oxypentyl 2-hexyldecanoate is sourced from PubChem (CID 171051892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).