C11H25NO3Si — CID 175131179
2-amino-5-[tert-butyl(dimethyl)silyl]oxypentanoic acid (PubChem CID 175131179) has the molecular formula C11H25NO3Si and a molecular weight of 247.41 g/mol. Its IUPAC name is 2-amino-5-[tert-butyl(dimethyl)silyl]oxypentanoic acid.
| Compound Name | 2-amino-5-[tert-butyl(dimethyl)silyl]oxypentanoic acid |
|---|---|
| PubChem CID | 175131179 |
| Molecular Formula | C11H25NO3Si |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-amino-5-[tert-butyl(dimethyl)silyl]oxypentanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(N)C(=O)O |
| InChI | InChI=1S/C11H25NO3Si/c1-11(2,3)16(4,5)15-8-6-7-9(12)10(13)14/h9H,6-8,12H2,1-5H3,(H,13,14) |
| InChIKey | CSLRZICYQIXLCN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|