C12H23F3O3Si — CID 140678729
2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,4-trifluorobutanoic acid (PubChem CID 140678729) has the molecular formula C12H23F3O3Si and a molecular weight of 300.39 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 140678729 |
| Molecular Formula | C12H23F3O3Si |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,4-trifluorobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H23F3O3Si/c1-11(2,3)19(4,5)18-7-6-9(10(16)17)8-12(13,14)15/h9H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | QPEVLOSPRBJLBL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|