C14H31NO5Si — CID 162143782
2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid;butanoic acid (PubChem CID 162143782) has the molecular formula C14H31NO5Si and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid;butanoic acid.
| Compound Name | 2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid;butanoic acid |
|---|---|
| PubChem CID | 162143782 |
| Molecular Formula | C14H31NO5Si |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2-amino-4-[tert-butyl(dimethyl)silyl]oxybutanoic acid;butanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(N)C(=O)O.CCCC(=O)O |
| InChI | InChI=1S/C10H23NO3Si.C4H8O2/c1-10(2,3)15(4,5)14-7-6-8(11)9(12)13;1-2-3-4(5)6/h8H,6-7,11H2,1-5H3,(H,12,13);2-3H2,1H3,(H,5,6) |
| InChIKey | ZKGXXOHNVFQEAR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|