C14H29NO5Si — CID 89136384
(2S,4S)-2-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pentanedioic acid (PubChem CID 89136384) has the molecular formula C14H29NO5Si and a molecular weight of 319.47 g/mol. Its IUPAC name is (2S,4S)-2-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pentanedioic acid.
| Compound Name | (2S,4S)-2-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pentanedioic acid |
|---|---|
| PubChem CID | 89136384 |
| Molecular Formula | C14H29NO5Si |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (2S,4S)-2-amino-4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pentanedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H](C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H29NO5Si/c1-14(2,3)21(4,5)20-8-6-7-10(12(16)17)9-11(15)13(18)19/h10-11H,6-9,15H2,1-5H3,(H,16,17)(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | RGZVNFPBLUAJNW-QWRGUYRKSA-N |
| XLogP | 2.29 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|