C8H14FNO4 — CID 88947507
(2S,4R)-2-amino-4-(3-fluoropropyl)pentanedioic acid (PubChem CID 88947507) has the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-(3-fluoropropyl)pentanedioic acid.
| Compound Name | (2S,4R)-2-amino-4-(3-fluoropropyl)pentanedioic acid |
|---|---|
| PubChem CID | 88947507 |
| Molecular Formula | C8H14FNO4 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2S,4R)-2-amino-4-(3-fluoropropyl)pentanedioic acid |
| SMILES | N[C@@H](C[C@@H](CCCF)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14FNO4/c9-3-1-2-5(7(11)12)4-6(10)8(13)14/h5-6H,1-4,10H2,(H,11,12)(H,13,14)/t5-,6+/m1/s1 |
| InChIKey | MKDNDKMECWBLOF-RITPCOANSA-N |
| XLogP | 0.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |