C22H27NO4 — CID 10339084
(2S,4S)-2-amino-4-(5,5-diphenylpentyl)pentanedioic acid (PubChem CID 10339084) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S,4S)-2-amino-4-(5,5-diphenylpentyl)pentanedioic acid.
| Compound Name | (2S,4S)-2-amino-4-(5,5-diphenylpentyl)pentanedioic acid |
|---|---|
| PubChem CID | 10339084 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S,4S)-2-amino-4-(5,5-diphenylpentyl)pentanedioic acid |
| SMILES | N[C@@H](C[C@H](CCCCC(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27NO4/c23-20(22(26)27)15-18(21(24)25)13-7-8-14-19(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,18-20H,7-8,13-15,23H2,(H,24,25)(H,26,27)/t18-,20-/m0/s1 |
| InChIKey | IRPMNASLBARATA-ICSRJNTNSA-N |
| XLogP | 3.88 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|