2-acetyl-10,10-diphenyldecanoic acid

C24H30O3 — CID 69432252

IUPAC2-acetyl-10,10-diphenyldecanoic acid
SMILESCC(=O)C(CCCCCCCC(c1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C24H30O3/c1-19(25)22(24(26)27)17-11-3-2-4-12-18-23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-23H,2-4,11-12,17-18H2,1H3,(H,26,27)
InChIKeyOAHRINAUXZEOGG-UHFFFAOYSA-N
MW366.50 g/mol
LogP5.84
Rot. Bonds12

About 2-acetyl-10,10-diphenyldecanoic acid

2-acetyl-10,10-diphenyldecanoic acid (PubChem CID 69432252) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-acetyl-10,10-diphenyldecanoic acid.

Molecular Properties

Compound Name2-acetyl-10,10-diphenyldecanoic acid
PubChem CID69432252
Molecular FormulaC24H30O3
Molecular Weight366.50 g/mol
Exact Mass366.22
IUPAC Name2-acetyl-10,10-diphenyldecanoic acid
SMILESCC(=O)C(CCCCCCCC(c1ccccc1)c1ccccc1)C(=O)O
InChIInChI=1S/C24H30O3/c1-19(25)22(24(26)27)17-11-3-2-4-12-18-23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-23H,2-4,11-12,17-18H2,1H3,(H,26,27)
InChIKeyOAHRINAUXZEOGG-UHFFFAOYSA-N
XLogP5.84
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500366.50
LogP ≤ 55.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-acetyl-10,10-diphenyldecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyl-10,10-diphenyldecanoic acid?
The IUPAC name of 2-acetyl-10,10-diphenyldecanoic acid (CID 69432252) is 2-acetyl-10,10-diphenyldecanoic acid.
What is the SMILES notation for 2-acetyl-10,10-diphenyldecanoic acid?
The canonical SMILES for 2-acetyl-10,10-diphenyldecanoic acid is CC(=O)C(CCCCCCCC(c1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 2-acetyl-10,10-diphenyldecanoic acid?
The InChIKey is OAHRINAUXZEOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O3/c1-19(25)22(24(26)27)17-11-3-2-4-12-18-23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-23H,2-4,11-12,17-18H2,1H3,(H,26,27).
What are the key properties of 2-acetyl-10,10-diphenyldecanoic acid?
2-acetyl-10,10-diphenyldecanoic acid has a molecular weight of 366.50 g/mol, XLogP of 5.84, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-10,10-diphenyldecanoic acid is sourced from PubChem (CID 69432252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).