C24H30O3 — CID 69432252
2-acetyl-10,10-diphenyldecanoic acid (PubChem CID 69432252) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-acetyl-10,10-diphenyldecanoic acid.
| Compound Name | 2-acetyl-10,10-diphenyldecanoic acid |
|---|---|
| PubChem CID | 69432252 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-acetyl-10,10-diphenyldecanoic acid |
| SMILES | CC(=O)C(CCCCCCCC(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H30O3/c1-19(25)22(24(26)27)17-11-3-2-4-12-18-23(20-13-7-5-8-14-20)21-15-9-6-10-16-21/h5-10,13-16,22-23H,2-4,11-12,17-18H2,1H3,(H,26,27) |
| InChIKey | OAHRINAUXZEOGG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|