C20H30O2 — CID 70400980
3-nonyl-1-phenylpentane-2,4-dione (PubChem CID 70400980) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-nonyl-1-phenylpentane-2,4-dione.
| Compound Name | 3-nonyl-1-phenylpentane-2,4-dione |
|---|---|
| PubChem CID | 70400980 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3-nonyl-1-phenylpentane-2,4-dione |
| SMILES | CCCCCCCCCC(C(C)=O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H30O2/c1-3-4-5-6-7-8-12-15-19(17(2)21)20(22)16-18-13-10-9-11-14-18/h9-11,13-14,19H,3-8,12,15-16H2,1-2H3 |
| InChIKey | PVRATZDFIJXWLJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|