About 1-phenylheptadecan-2-one
1-phenylheptadecan-2-one (PubChem CID 12920609) has the molecular formula C23H38O
and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-phenylheptadecan-2-one.
Molecular Properties
| Compound Name | 1-phenylheptadecan-2-one |
| PubChem CID | 12920609 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 1-phenylheptadecan-2-one |
| SMILES | CCCCCCCCCCCCCCCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H38O/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23(24)21-22-18-15-14-16-19-22/h14-16,18-19H,2-13,17,20-21H2,1H3 |
| InChIKey | BERWCEXPPPHSGW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylheptadecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylheptadecan-2-one?
The IUPAC name of 1-phenylheptadecan-2-one (CID 12920609) is 1-phenylheptadecan-2-one.
What is the SMILES notation for 1-phenylheptadecan-2-one?
The canonical SMILES for 1-phenylheptadecan-2-one is CCCCCCCCCCCCCCCC(=O)Cc1ccccc1.
What is the InChIKey of 1-phenylheptadecan-2-one?
The InChIKey is BERWCEXPPPHSGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38O/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23(24)21-22-18-15-14-16-19-22/h14-16,18-19H,2-13,17,20-21H2,1H3.
What are the key properties of 1-phenylheptadecan-2-one?
1-phenylheptadecan-2-one has a molecular weight of 330.56 g/mol, XLogP of 7.28, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylheptadecan-2-one is sourced from PubChem (CID 12920609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).