About 1,1'-biphenyl;heptadecan-9-one
1,1'-biphenyl;heptadecan-9-one (PubChem CID 19613965) has the molecular formula C29H44O
and a molecular weight of 408.67 g/mol. Its IUPAC name is 1,1'-biphenyl;heptadecan-9-one.
Molecular Properties
| Compound Name | 1,1'-biphenyl;heptadecan-9-one |
| PubChem CID | 19613965 |
| Molecular Formula | C29H44O |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | 1,1'-biphenyl;heptadecan-9-one |
| SMILES | CCCCCCCCC(=O)CCCCCCCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H34O.C12H10/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-16H2,1-2H3;1-10H |
| InChIKey | JLMLHMQJHUSURS-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;heptadecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;heptadecan-9-one?
The IUPAC name of 1,1'-biphenyl;heptadecan-9-one (CID 19613965) is 1,1'-biphenyl;heptadecan-9-one.
What is the SMILES notation for 1,1'-biphenyl;heptadecan-9-one?
The canonical SMILES for 1,1'-biphenyl;heptadecan-9-one is CCCCCCCCC(=O)CCCCCCCC.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;heptadecan-9-one?
The InChIKey is JLMLHMQJHUSURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O.C12H10/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-16H2,1-2H3;1-10H.
What are the key properties of 1,1'-biphenyl;heptadecan-9-one?
1,1'-biphenyl;heptadecan-9-one has a molecular weight of 408.67 g/mol, XLogP of 9.41, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;heptadecan-9-one is sourced from PubChem (CID 19613965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).