About 1,1'-biphenyl;methyl tetradecanoate
1,1'-biphenyl;methyl tetradecanoate (PubChem CID 175273282) has the molecular formula C27H40O2
and a molecular weight of 396.62 g/mol. Its IUPAC name is 1,1'-biphenyl;methyl tetradecanoate.
Molecular Properties
| Compound Name | 1,1'-biphenyl;methyl tetradecanoate |
| PubChem CID | 175273282 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1,1'-biphenyl;methyl tetradecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)OC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H30O2.C12H10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-14H2,1-2H3;1-10H |
| InChIKey | MLLXJGLKSUFTOH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;methyl tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;methyl tetradecanoate?
The IUPAC name of 1,1'-biphenyl;methyl tetradecanoate (CID 175273282) is 1,1'-biphenyl;methyl tetradecanoate.
What is the SMILES notation for 1,1'-biphenyl;methyl tetradecanoate?
The canonical SMILES for 1,1'-biphenyl;methyl tetradecanoate is CCCCCCCCCCCCCC(=O)OC.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;methyl tetradecanoate?
The InChIKey is MLLXJGLKSUFTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2.C12H10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-14H2,1-2H3;1-10H.
What are the key properties of 1,1'-biphenyl;methyl tetradecanoate?
1,1'-biphenyl;methyl tetradecanoate has a molecular weight of 396.62 g/mol, XLogP of 8.21, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;methyl tetradecanoate is sourced from PubChem (CID 175273282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).