About methyl octadecanoate;methyl octanoate
methyl octadecanoate;methyl octanoate (PubChem CID 157178883) has the molecular formula C28H56O4
and a molecular weight of 456.75 g/mol. Its IUPAC name is methyl octadecanoate;methyl octanoate.
Molecular Properties
| Compound Name | methyl octadecanoate;methyl octanoate |
| PubChem CID | 157178883 |
| Molecular Formula | C28H56O4 |
| Molecular Weight | 456.75 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | methyl octadecanoate;methyl octanoate |
| SMILES | CCCCCCCC(=O)OC.CCCCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H38O2.C9H18O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;1-3-4-5-6-7-8-9(10)11-2/h3-18H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | AOINWTVQOHHFNP-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.75 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl octadecanoate;methyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl octadecanoate;methyl octanoate?
The IUPAC name of methyl octadecanoate;methyl octanoate (CID 157178883) is methyl octadecanoate;methyl octanoate.
What is the SMILES notation for methyl octadecanoate;methyl octanoate?
The canonical SMILES for methyl octadecanoate;methyl octanoate is CCCCCCCC(=O)OC.CCCCCCCCCCCCCCCCCC(=O)OC.
What is the InChIKey of methyl octadecanoate;methyl octanoate?
The InChIKey is AOINWTVQOHHFNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O2.C9H18O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;1-3-4-5-6-7-8-9(10)11-2/h3-18H2,1-2H3;3-8H2,1-2H3.
What are the key properties of methyl octadecanoate;methyl octanoate?
methyl octadecanoate;methyl octanoate has a molecular weight of 456.75 g/mol, XLogP of 8.94, 22 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl octadecanoate;methyl octanoate is sourced from PubChem (CID 157178883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).