About ethane;methyl hexanoate
ethane;methyl hexanoate (PubChem CID 159004993) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is ethane;methyl hexanoate.
Molecular Properties
| Compound Name | ethane;methyl hexanoate |
| PubChem CID | 159004993 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | ethane;methyl hexanoate |
| SMILES | CC.CCCCCC(=O)OC |
| InChI | InChI=1S/C7H14O2.C2H6/c1-3-4-5-6-7(8)9-2;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | JRUSPZCOVBAGEK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl hexanoate?
The IUPAC name of ethane;methyl hexanoate (CID 159004993) is ethane;methyl hexanoate.
What is the SMILES notation for ethane;methyl hexanoate?
The canonical SMILES for ethane;methyl hexanoate is CC.CCCCCC(=O)OC.
What is the InChIKey of ethane;methyl hexanoate?
The InChIKey is JRUSPZCOVBAGEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C2H6/c1-3-4-5-6-7(8)9-2;1-2/h3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl hexanoate?
ethane;methyl hexanoate has a molecular weight of 160.26 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl hexanoate is sourced from PubChem (CID 159004993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).