About acetic acid;methyl hexanoate
acetic acid;methyl hexanoate (PubChem CID 174781509) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is acetic acid;methyl hexanoate.
Molecular Properties
| Compound Name | acetic acid;methyl hexanoate |
| PubChem CID | 174781509 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | acetic acid;methyl hexanoate |
| SMILES | CC(=O)O.CCCCCC(=O)OC |
| InChI | InChI=1S/C7H14O2.C2H4O2/c1-3-4-5-6-7(8)9-2;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4) |
| InChIKey | SHSXVOHDBUWMGG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methyl hexanoate?
The IUPAC name of acetic acid;methyl hexanoate (CID 174781509) is acetic acid;methyl hexanoate.
What is the SMILES notation for acetic acid;methyl hexanoate?
The canonical SMILES for acetic acid;methyl hexanoate is CC(=O)O.CCCCCC(=O)OC.
What is the InChIKey of acetic acid;methyl hexanoate?
The InChIKey is SHSXVOHDBUWMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C2H4O2/c1-3-4-5-6-7(8)9-2;1-2(3)4/h3-6H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;methyl hexanoate?
acetic acid;methyl hexanoate has a molecular weight of 190.24 g/mol, XLogP of 1.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methyl hexanoate is sourced from PubChem (CID 174781509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).