About methyl nonanoate;hydrochloride
methyl nonanoate;hydrochloride (PubChem CID 141151355) has the molecular formula C10H21ClO2
and a molecular weight of 208.73 g/mol. Its IUPAC name is methyl nonanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl nonanoate;hydrochloride |
| PubChem CID | 141151355 |
| Molecular Formula | C10H21ClO2 |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | methyl nonanoate;hydrochloride |
| SMILES | CCCCCCCCC(=O)OC.Cl |
| InChI | InChI=1S/C10H20O2.ClH/c1-3-4-5-6-7-8-9-10(11)12-2;/h3-9H2,1-2H3;1H |
| InChIKey | XLEZKHGBZUFIAF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl nonanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl nonanoate;hydrochloride?
The IUPAC name of methyl nonanoate;hydrochloride (CID 141151355) is methyl nonanoate;hydrochloride.
What is the SMILES notation for methyl nonanoate;hydrochloride?
The canonical SMILES for methyl nonanoate;hydrochloride is CCCCCCCCC(=O)OC.Cl.
What is the InChIKey of methyl nonanoate;hydrochloride?
The InChIKey is XLEZKHGBZUFIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.ClH/c1-3-4-5-6-7-8-9-10(11)12-2;/h3-9H2,1-2H3;1H.
What are the key properties of methyl nonanoate;hydrochloride?
methyl nonanoate;hydrochloride has a molecular weight of 208.73 g/mol, XLogP of 3.33, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl nonanoate;hydrochloride is sourced from PubChem (CID 141151355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).