About 1-phenoxytridecan-3-one
1-phenoxytridecan-3-one (PubChem CID 63411817) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-phenoxytridecan-3-one.
Molecular Properties
| Compound Name | 1-phenoxytridecan-3-one |
| PubChem CID | 63411817 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-phenoxytridecan-3-one |
| SMILES | CCCCCCCCCCC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-10-13-18(20)16-17-21-19-14-11-9-12-15-19/h9,11-12,14-15H,2-8,10,13,16-17H2,1H3 |
| InChIKey | GLKXVYFGYBHLGV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxytridecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxytridecan-3-one?
The IUPAC name of 1-phenoxytridecan-3-one (CID 63411817) is 1-phenoxytridecan-3-one.
What is the SMILES notation for 1-phenoxytridecan-3-one?
The canonical SMILES for 1-phenoxytridecan-3-one is CCCCCCCCCCC(=O)CCOc1ccccc1.
What is the InChIKey of 1-phenoxytridecan-3-one?
The InChIKey is GLKXVYFGYBHLGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-10-13-18(20)16-17-21-19-14-11-9-12-15-19/h9,11-12,14-15H,2-8,10,13,16-17H2,1H3.
What are the key properties of 1-phenoxytridecan-3-one?
1-phenoxytridecan-3-one has a molecular weight of 290.45 g/mol, XLogP of 5.56, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxytridecan-3-one is sourced from PubChem (CID 63411817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).