About 8-oxo-9-phenylnonanoic acid
8-oxo-9-phenylnonanoic acid (PubChem CID 58119944) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 8-oxo-9-phenylnonanoic acid.
Molecular Properties
| Compound Name | 8-oxo-9-phenylnonanoic acid |
| PubChem CID | 58119944 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 8-oxo-9-phenylnonanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c16-14(12-13-8-4-3-5-9-13)10-6-1-2-7-11-15(17)18/h3-5,8-9H,1-2,6-7,10-12H2,(H,17,18) |
| InChIKey | MJFRDWAYODHLRV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-oxo-9-phenylnonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxo-9-phenylnonanoic acid?
The IUPAC name of 8-oxo-9-phenylnonanoic acid (CID 58119944) is 8-oxo-9-phenylnonanoic acid.
What is the SMILES notation for 8-oxo-9-phenylnonanoic acid?
The canonical SMILES for 8-oxo-9-phenylnonanoic acid is O=C(O)CCCCCCC(=O)Cc1ccccc1.
What is the InChIKey of 8-oxo-9-phenylnonanoic acid?
The InChIKey is MJFRDWAYODHLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c16-14(12-13-8-4-3-5-9-13)10-6-1-2-7-11-15(17)18/h3-5,8-9H,1-2,6-7,10-12H2,(H,17,18).
What are the key properties of 8-oxo-9-phenylnonanoic acid?
8-oxo-9-phenylnonanoic acid has a molecular weight of 248.32 g/mol, XLogP of 3.22, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxo-9-phenylnonanoic acid is sourced from PubChem (CID 58119944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).