C22H29NO — CID 22444310
11-phenyl-11-pyridin-3-ylundecan-2-one (PubChem CID 22444310) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 11-phenyl-11-pyridin-3-ylundecan-2-one.
| Compound Name | 11-phenyl-11-pyridin-3-ylundecan-2-one |
|---|---|
| PubChem CID | 22444310 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 11-phenyl-11-pyridin-3-ylundecan-2-one |
| SMILES | CC(=O)CCCCCCCCC(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C22H29NO/c1-19(24)12-7-4-2-3-5-10-16-22(20-13-8-6-9-14-20)21-15-11-17-23-18-21/h6,8-9,11,13-15,17-18,22H,2-5,7,10,12,16H2,1H3 |
| InChIKey | AOWUBEDNYROZMT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|