C25H34N2 — CID 164948672
(2E)-3,7-dimethyl-N-(4-phenyl-4-pyridin-3-ylbutyl)octa-2,6-dien-1-amine (PubChem CID 164948672) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-(4-phenyl-4-pyridin-3-ylbutyl)octa-2,6-dien-1-amine.
| Compound Name | (2E)-3,7-dimethyl-N-(4-phenyl-4-pyridin-3-ylbutyl)octa-2,6-dien-1-amine |
|---|---|
| PubChem CID | 164948672 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (2E)-3,7-dimethyl-N-(4-phenyl-4-pyridin-3-ylbutyl)octa-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCCC(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C25H34N2/c1-21(2)10-7-11-22(3)16-19-26-17-9-15-25(23-12-5-4-6-13-23)24-14-8-18-27-20-24/h4-6,8,10,12-14,16,18,20,25-26H,7,9,11,15,17,19H2,1-3H3/b22-16+ |
| InChIKey | NUWQZMCIIMEHBH-CJLVFECKSA-N |
| XLogP | 6.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|