C21H43N3 — CID 147822843
N'-[3-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]propyl]octane-1,8-diamine (PubChem CID 147822843) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is N'-[3-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]propyl]octane-1,8-diamine.
| Compound Name | N'-[3-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]propyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 147822843 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | N'-[3-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]propyl]octane-1,8-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCCNCCCCCCCCN |
| InChI | InChI=1S/C21H43N3/c1-20(2)12-10-13-21(3)14-19-24-18-11-17-23-16-9-7-5-4-6-8-15-22/h12,14,23-24H,4-11,13,15-19,22H2,1-3H3/b21-14+ |
| InChIKey | HPONTOCPDYYKBH-KGENOOAVSA-N |
| XLogP | 4.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|