C7H16N2 — CID 107899865
N'-(3-methylbut-2-enyl)ethane-1,2-diamine (PubChem CID 107899865) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is N'-(3-methylbut-2-enyl)ethane-1,2-diamine.
| Compound Name | N'-(3-methylbut-2-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107899865 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | N'-(3-methylbut-2-enyl)ethane-1,2-diamine |
| SMILES | CC(C)=CCNCCN |
| InChI | InChI=1S/C7H16N2/c1-7(2)3-5-9-6-4-8/h3,9H,4-6,8H2,1-2H3 |
| InChIKey | FZJMPMVCGUIQOW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|