C23H39N — CID 165083551
(2E)-N-[3-(1-adamantyl)propyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 165083551) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is (2E)-N-[3-(1-adamantyl)propyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2E)-N-[3-(1-adamantyl)propyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 165083551 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | (2E)-N-[3-(1-adamantyl)propyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H39N/c1-18(2)6-4-7-19(3)8-11-24-10-5-9-23-15-20-12-21(16-23)14-22(13-20)17-23/h6,8,20-22,24H,4-5,7,9-17H2,1-3H3/b19-8+ |
| InChIKey | KRERGUCEIZTIJR-UFWORHAWSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|